* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ A3 0063 |
| EnglishSynonyms: | RARECHEM AQ A3 0063 |
| pro_mdlNumber: | MFCD06227537 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)C(C(=O)NC)N(C)C(=O)[C@@H](c1ccccc1)O |
| InChi: | InChI=1S/C16H24N2O3/c1-16(2,3)13(14(20)17-4)18(5)15(21)12(19)11-9-7-6-8-10-11/h6-10,12-13,19H,1-5H3,(H,17,20)/t12-,13?/m1/s1 |
| InChiKey: | InChIKey=NJSOUJKFEBKWLZ-PZORYLMUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.