* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ A3 0064 |
| EnglishSynonyms: | RARECHEM AQ A3 0064 |
| pro_mdlNumber: | MFCD06227538 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)[C@H](C(=O)NC)N(C)C(=O)c1ccccc1 |
| InChi: | InChI=1S/C15H22N2O2/c1-15(2,3)12(13(18)16-4)17(5)14(19)11-9-7-6-8-10-11/h6-10,12H,1-5H3,(H,16,18)/t12-/m0/s1 |
| InChiKey: | InChIKey=LBVOSHOPBNJRCZ-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.