* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ A3 0065 |
| EnglishSynonyms: | RARECHEM AQ A3 0065 |
| pro_mdlNumber: | MFCD06227539 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)[C@H](C(=O)NC)N(C)C(=O)CNC(=O)c1ccccc1 |
| InChi: | InChI=1S/C17H25N3O3/c1-17(2,3)14(16(23)18-4)20(5)13(21)11-19-15(22)12-9-7-6-8-10-12/h6-10,14H,11H2,1-5H3,(H,18,23)(H,19,22)/t14-/m0/s1 |
| InChiKey: | InChIKey=YLWUMJGPFHHJGC-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.