* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ A3 0066 |
| EnglishSynonyms: | RARECHEM AQ A3 0066 |
| pro_mdlNumber: | MFCD06227540 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)[C@H](C(=O)N(C)C)[NH2+]C.C(F)(F)(F)S(=O)(=O)[O-] |
| InChi: | InChI=1S/C9H20N2O.CHF3O3S/c1-9(2,3)7(10-4)8(12)11(5)6;2-1(3,4)8(5,6)7/h7,10H,1-6H3;(H,5,6,7)/t7-;/m0./s1 |
| InChiKey: | InChIKey=JZWBUWYIXLVUMQ-FJXQXJEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.