* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ A3 0140 |
| EnglishSynonyms: | RARECHEM AQ A3 0140 |
| pro_mdlNumber: | MFCD06227541 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)[C@@H](/C(=[NH+]\C(C)(C)C)/NC)Br.c1ccc(cc1)[C@@H](C(=O)[O-])O |
| InChi: | InChI=1S/C11H23BrN2.C8H8O3/c1-10(2,3)8(12)9(13-7)14-11(4,5)6;9-7(8(10)11)6-4-2-1-3-5-6/h8H,1-7H3,(H,13,14);1-5,7,9H,(H,10,11)/t8-;7-/m10/s1 |
| InChiKey: | InChIKey=SITBGCRXVHIITC-PMXXSWPTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.