* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8012 |
| EnglishSynonyms: | RARECHEM AQ BC 8012 |
| pro_mdlNumber: | MFCD06227544 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1ccc(cc1)[C@H]2CC(=O)[C@H]3[C@@H]2[C@@](C[C@@H]3c4ccccc4)(c5ccccc5)O |
| InChi: | InChI=1S/C26H24O2/c27-23-16-21(18-10-4-1-5-11-18)25-24(23)22(19-12-6-2-7-13-19)17-26(25,28)20-14-8-3-9-15-20/h1-15,21-22,24-25,28H,16-17H2/t21-,22-,24+,25-,26-/m1/s1 |
| InChiKey: | InChIKey=ICOZIKNFKNHSAH-BWIKSPBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.