* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8014 |
| EnglishSynonyms: | RARECHEM AQ BC 8014 |
| pro_mdlNumber: | MFCD06227546 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | c1ccc(cc1)[C@@H]2C=C([C@@H]3[C@H]2C(=C[C@H]3c4ccccc4)c5ccccc5)c6ccccc6 |
| InChi: | InChI=1S/C32H26/c1-5-13-23(14-6-1)27-21-28(24-15-7-2-8-16-24)32-30(26-19-11-4-12-20-26)22-29(31(27)32)25-17-9-3-10-18-25/h1-22,27,30-32H/t27-,30-,31+,32-/m0/s1 |
| InChiKey: | InChIKey=AOCSQVYBUVHCPJ-ZKKLFSJWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.