* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8018 |
| EnglishSynonyms: | RARECHEM AQ BC 8018 |
| pro_mdlNumber: | MFCD06227549 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | COC(=O)[C@@H]1[C@H]2CC=C([C@H]2C[C@@H]1Cl)C(=O)OC |
| InChi: | InChI=1S/C12H15ClO4/c1-16-11(14)7-4-3-6-8(7)5-9(13)10(6)12(15)17-2/h4,6,8-10H,3,5H2,1-2H3/t6-,8-,9-,10+/m0/s1 |
| InChiKey: | InChIKey=KMHODRLLVQJHRO-MIBSWOBISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.