* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AQ BC 8041 |
EnglishSynonyms: | RARECHEM AQ BC 8041 |
pro_mdlNumber: | MFCD06227552 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | C[C@]12CC=C[C@]1([C@@H](CC2=O)C#N)C |
InChi: | InChI=1S/C11H13NO/c1-10-4-3-5-11(10,2)9(13)6-8(10)7-12/h3-4,8H,5-6H2,1-2H3/t8-,10-,11+/m0/s1 |
InChiKey: | InChIKey=RWEQJNSQIPMNQY-INTQDDNPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.