* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8042 |
| EnglishSynonyms: | RARECHEM AQ BC 8042 |
| pro_mdlNumber: | MFCD06227553 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | C[C@@]12CC=C[C@@]1(C(=O)C[C@H]2C#N)C |
| InChi: | InChI=1S/C11H13NO/c1-10-4-3-5-11(10,2)9(13)6-8(10)7-12/h3,5,8H,4,6H2,1-2H3/t8-,10-,11+/m0/s1 |
| InChiKey: | InChIKey=XBCUZDYIDFXMMR-INTQDDNPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.