* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8050 |
| EnglishSynonyms: | RARECHEM AQ BC 8050 |
| pro_mdlNumber: | MFCD06227554 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | C[C@]12C=C[C@@H]([C@]1(C=C[C@@H]2Br)C)Br |
| InChi: | InChI=1S/C10H12Br2/c1-9-5-3-8(12)10(9,2)6-4-7(9)11/h3-8H,1-2H3/t7-,8-,9+,10+/m0/s1 |
| InChiKey: | InChIKey=SOHHSGFRQRQZKQ-AXTSPUMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.