* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8070 |
| EnglishSynonyms: | RARECHEM AQ BC 8070 |
| pro_mdlNumber: | MFCD06227555 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | C[C@@]12CCC[C@@]1(C(C[C@H]2C#N)(C#N)O[Si](C)(C)C)C |
| InChi: | InChI=1S/C15H24N2OSi/c1-13-7-6-8-14(13,2)15(11-17,9-12(13)10-16)18-19(3,4)5/h12H,6-9H2,1-5H3/t12-,13-,14-,15?/m0/s1 |
| InChiKey: | InChIKey=YDDPMKKRMBAENQ-LOKSQKBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.