* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 8083 |
| EnglishSynonyms: | RARECHEM AQ BC 8083 |
| pro_mdlNumber: | MFCD06227560 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | C[C@]12CC[C@@]([C@]1(CC[C@@]2(C#Cc3ccccc3)O)C)(C#Cc4ccccc4)O |
| InChi: | InChI=1S/C26H26O2/c1-23-17-19-26(28,16-14-22-11-7-4-8-12-22)24(23,2)18-20-25(23,27)15-13-21-9-5-3-6-10-21/h3-12,27-28H,17-20H2,1-2H3/t23-,24-,25+,26+/m0/s1 |
| InChiKey: | InChIKey=FVBWSTVWABFISS-QEGGNFSNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.