* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 9073 |
| EnglishSynonyms: | RARECHEM AQ BC 9073 |
| pro_mdlNumber: | MFCD06227587 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | C1[C@H]2C=C([C@@H]([C@@H]1C=C([C@@H]2Br)C#N)Br)C#N |
| InChi: | InChI=1S/C11H8Br2N2/c12-10-6-1-7(3-9(10)5-15)11(13)8(2-6)4-14/h2-3,6-7,10-11H,1H2/t6?,7?,10-,11-/m1/s1 |
| InChiKey: | InChIKey=PJYWBFZIFYSDOD-VMLKCIBOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.