* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ BC 9102 |
| EnglishSynonyms: | RARECHEM AQ BC 9102 |
| pro_mdlNumber: | MFCD06227608 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | C1[C@@H]2[C@@H](C=C([C@@H]1[C@@H](C=C2C(F)(F)F)Br)C(F)(F)F)Br |
| InChi: | InChI=1S/C11H8Br2F6/c12-8-2-6(10(14,15)16)4-1-5(8)7(3-9(4)13)11(17,18)19/h2-5,8-9H,1H2/t4?,5?,8-,9-/m1/s1 |
| InChiKey: | InChIKey=AFPADDQMBRLUNG-KOTNCPIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.