* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ C3 0017 |
| EnglishSynonyms: | RARECHEM AQ C3 0017 |
| pro_mdlNumber: | MFCD06227622 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(c(c1)/C=N/[C@H]2C[C@@H]2/N=C/c3ccccc3O)O |
| InChi: | InChI=1S/C17H16N2O2/c20-16-7-3-1-5-12(16)10-18-14-9-15(14)19-11-13-6-2-4-8-17(13)21/h1-8,10-11,14-15,20-21H,9H2/b18-10+,19-11+/t14-,15-/m0/s1 |
| InChiKey: | InChIKey=WJAKKCMFSQTOIG-HHSQGRDRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.