* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ C3 0019 |
| EnglishSynonyms: | RARECHEM AQ C3 0019 |
| pro_mdlNumber: | MFCD06227624 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)c1cc(cc(c1)C(C)(C)C)/C=N/[C@H]2C[C@@H]2/N=C/c3cc(cc(c3)C(C)(C)C)C(C)(C)C |
| InChi: | InChI=1S/C33H48N2/c1-30(2,3)24-13-22(14-25(17-24)31(4,5)6)20-34-28-19-29(28)35-21-23-15-26(32(7,8)9)18-27(16-23)33(10,11)12/h13-18,20-21,28-29H,19H2,1-12H3/b34-20+,35-21+/t28-,29-/m0/s1 |
| InChiKey: | InChIKey=FUSLTDGJUJVQRN-QKZBHSRGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.