* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ C4 0022 |
| EnglishSynonyms: | RARECHEM AQ C4 0022 |
| pro_mdlNumber: | MFCD06227643 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | Cc1ccc(cc1)/C=N/[C@H]2CC[C@@H]2/N=C/c3ccc(cc3)C |
| InChi: | InChI=1S/C20H22N2/c1-15-3-7-17(8-4-15)13-21-19-11-12-20(19)22-14-18-9-5-16(2)6-10-18/h3-10,13-14,19-20H,11-12H2,1-2H3/b21-13+,22-14+/t19-,20-/m0/s1 |
| InChiKey: | InChIKey=DSHNARJVYDKBSJ-JPNTUTKCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.