* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ C4 0023 |
| EnglishSynonyms: | RARECHEM AQ C4 0023 |
| pro_mdlNumber: | MFCD06227644 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | c1cc(ccc1/C=N/[C@H]2CC[C@@H]2/N=C/c3ccc(cc3)Cl)Cl |
| InChi: | InChI=1S/C18H16Cl2N2/c19-15-5-1-13(2-6-15)11-21-17-9-10-18(17)22-12-14-3-7-16(20)8-4-14/h1-8,11-12,17-18H,9-10H2/b21-11+,22-12+/t17-,18-/m0/s1 |
| InChiKey: | InChIKey=HEKGWZDIICAKCD-RPCWHEIMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.