* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ C5 0003 |
| EnglishSynonyms: | RARECHEM AQ C5 0003 |
| pro_mdlNumber: | MFCD06227648 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | C[C@@]1(CCC(=O)[C@]1(C)CCC(=O)O)C(=O)OC |
| InChi: | InChI=1S/C12H18O5/c1-11(7-5-9(14)15)8(13)4-6-12(11,2)10(16)17-3/h4-7H2,1-3H3,(H,14,15)/t11-,12+/m0/s1 |
| InChiKey: | InChIKey=VZVANZLVEGRLGM-NWDGAFQWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.