* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ C5 0004 |
| EnglishSynonyms: | RARECHEM AQ C5 0004 |
| pro_mdlNumber: | MFCD06227649 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | C[C@@]1(CC(C(=O)[C@]1(C)CCC#N)C#N)C(=O)OC |
| InChi: | InChI=1S/C13H16N2O3/c1-12(5-4-6-14)10(16)9(8-15)7-13(12,2)11(17)18-3/h9H,4-5,7H2,1-3H3/t9?,12-,13+/m0/s1 |
| InChiKey: | InChIKey=WIRRDMDKRGEHSP-COKTVNPCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.