* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ NN 0136 |
| EnglishSynonyms: | RARECHEM AQ NN 0136 |
| pro_mdlNumber: | MFCD06227668 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC[C@]1(C([C@](N=N1)(C)CC)O)C |
| InChi: | InChI=1S/C9H18N2O/c1-5-8(3)7(12)9(4,6-2)11-10-8/h7,12H,5-6H2,1-4H3/t8-,9-/m0/s1 |
| InChiKey: | InChIKey=HAMHJPQBXIKCTK-IUCAKERBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.