* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL MD 0628 |
| EnglishSynonyms: | RARECHEM AL MD 0628 |
| pro_mdlNumber: | MFCD07388784 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | Cc1cccnc1CC(C(=O)O)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C14H20N2O4/c1-9-6-5-7-15-10(9)8-11(12(17)18)16-13(19)20-14(2,3)4/h5-7,11H,8H2,1-4H3,(H,16,19)(H,17,18) |
| InChiKey: | InChIKey=DSJXTJZRCOLMEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.