* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ N5 4122 |
| EnglishSynonyms: | RARECHEM AQ N5 4122 |
| pro_mdlNumber: | MFCD07434606 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)c1n(nn[n+]1[C@]23C[C@@H]4C[C@H](C2)C[C@@H](C4)C3)C.[O-]S(=O)(=O)F |
| InChi: | InChI=1S/C15H25N4.FHO3S/c1-10(2)14-18(3)16-17-19(14)15-7-11-4-12(8-15)6-13(5-11)9-15;1-5(2,3)4/h10-13H,4-9H2,1-3H3;(H,2,3,4)/q+1;/p-1/t11-,12+,13-,15-; |
| InChiKey: | InChIKey=NZDAZDKKVKPOEM-MIFQLHRHSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.