* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9,12,15 HEXADECATRIENOIC ACID |
| CAS: | 66753-70-6 |
| EnglishSynonyms: | 9,12,15 HEXADECATRIENOIC ACID |
| pro_mdlNumber: | MFCD08064028 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C=CC/C=C/C/C=C/CCCCCCCC(=O)O |
| InChi: | InChI=1S/C16H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2,4-5,7-8H,1,3,6,9-15H2,(H,17,18)/b5-4+,8-7+ |
| InChiKey: | InChIKey=OAXMYGCFSSOPQP-AOSYACOCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.