* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 0337 |
| EnglishSynonyms: | RARECHEM AN KA 0337 |
| pro_mdlNumber: | MFCD08448883 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCCCCCCCCOc1ccc(cc1)CCN |
| InChi: | InChI=1S/C18H31NO/c1-2-3-4-5-6-7-8-9-16-20-18-12-10-17(11-13-18)14-15-19/h10-13H,2-9,14-16,19H2,1H3 |
| InChiKey: | InChIKey=COTRFEDWVCDEJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.