* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 0498 |
| EnglishSynonyms: | RARECHEM AN KA 0498 |
| pro_mdlNumber: | MFCD08448982 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC(C)(C)c1ccc(cc1)CSc2c(c(nn2C)C(F)(F)F)CCN |
| InChi: | InChI=1S/C18H24F3N3S/c1-17(2,3)13-7-5-12(6-8-13)11-25-16-14(9-10-22)15(18(19,20)21)23-24(16)4/h5-8H,9-11,22H2,1-4H3 |
| InChiKey: | InChIKey=TUTQYZVGLPBIAQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.