* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 1085 |
| EnglishSynonyms: | RARECHEM AN KA 1085 |
| pro_mdlNumber: | MFCD08449433 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)C(=O)Nc1cnccc1CCN |
| InChi: | InChI=1S/C12H19N3O/c1-12(2,3)11(16)15-10-8-14-7-5-9(10)4-6-13/h5,7-8H,4,6,13H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=MDCNUZAMXBRAEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.