* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 1090 |
| EnglishSynonyms: | RARECHEM AN KA 1090 |
| pro_mdlNumber: | MFCD08449438 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | Cn1c(c(c(n1)c2ccccc2)CCN)S(=O)(=O)c3ccc(cc3)OC |
| InChi: | InChI=1S/C19H21N3O3S/c1-22-19(26(23,24)16-10-8-15(25-2)9-11-16)17(12-13-20)18(21-22)14-6-4-3-5-7-14/h3-11H,12-13,20H2,1-2H3 |
| InChiKey: | InChIKey=AGNYTFCCDMEESR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.