* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 1494 |
| EnglishSynonyms: | RARECHEM AN KA 1494 |
| pro_mdlNumber: | MFCD08449712 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | c1cc(ncc1CCN)OC2CCCCC2 |
| InChi: | InChI=1S/C13H20N2O/c14-9-8-11-6-7-13(15-10-11)16-12-4-2-1-3-5-12/h6-7,10,12H,1-5,8-9,14H2 |
| InChiKey: | InChIKey=ZBOZWWXYFQKABX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.