* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 1921 |
| EnglishSynonyms: | RARECHEM AN KA 1921 |
| pro_mdlNumber: | MFCD08450095 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCOc1c(cc(cc1Cl)CC)CCN |
| InChi: | InChI=1S/C13H20ClNO/c1-3-7-16-13-11(5-6-15)8-10(4-2)9-12(13)14/h8-9H,3-7,15H2,1-2H3 |
| InChiKey: | InChIKey=ZFNCXAZMNSJYGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.