* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KA 1972 |
| EnglishSynonyms: | RARECHEM AN KA 1972 |
| pro_mdlNumber: | MFCD08450145 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCOc1ccc(cc1CCN)C2CCCCC2 |
| InChi: | InChI=1S/C16H25NO/c1-2-18-16-9-8-14(12-15(16)10-11-17)13-6-4-3-5-7-13/h8-9,12-13H,2-7,10-11,17H2,1H3 |
| InChiKey: | InChIKey=MTWIKMNUPNOHBR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.