* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 0405 |
| EnglishSynonyms: | RARECHEM AN KB 0405 |
| pro_mdlNumber: | MFCD08450855 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1cc(ccc1F)C(F)(F)F)N |
| InChi: | InChI=1S/C11H13F4N/c1-2-9(16)6-7-5-8(11(13,14)15)3-4-10(7)12/h3-5,9H,2,6,16H2,1H3 |
| InChiKey: | InChIKey=PWRJAYMARLNURM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.