* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 0751 |
| EnglishSynonyms: | RARECHEM AN KB 0751 |
| pro_mdlNumber: | MFCD08451138 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1ccc(o1)c2ccc(c(c2)C(F)(F)F)F)N |
| InChi: | InChI=1S/C15H15F4NO/c1-2-10(20)8-11-4-6-14(21-11)9-3-5-13(16)12(7-9)15(17,18)19/h3-7,10H,2,8,20H2,1H3 |
| InChiKey: | InChIKey=CZQICEZALWZWCK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.