* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 1330 |
| EnglishSynonyms: | RARECHEM AN KB 1330 |
| pro_mdlNumber: | MFCD08451619 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1cn(c2c1cccc2)S(=O)(=O)c3ccccc3)N.Cl |
| InChi: | InChI=1S/C18H20N2O2S.ClH/c1-2-15(19)12-14-13-20(18-11-7-6-10-17(14)18)23(21,22)16-8-4-3-5-9-16;/h3-11,13,15H,2,12,19H2,1H3;1H |
| InChiKey: | InChIKey=PHESALGSEMWRAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.