* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 1581 |
| EnglishSynonyms: | RARECHEM AN KB 1581 |
| pro_mdlNumber: | MFCD08451803 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1ccc(cc1OC)C(F)(F)F)N.Cl |
| InChi: | InChI=1S/C12H16F3NO.ClH/c1-3-10(16)6-8-4-5-9(12(13,14)15)7-11(8)17-2;/h4-5,7,10H,3,6,16H2,1-2H3;1H |
| InChiKey: | InChIKey=UOVPLUATCXDMOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.