* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 1592 |
| EnglishSynonyms: | RARECHEM AN KB 1592 |
| pro_mdlNumber: | MFCD08451814 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1c(cccc1Cl)C(F)(F)F)N.Cl |
| InChi: | InChI=1S/C11H13ClF3N.ClH/c1-2-7(16)6-8-9(11(13,14)15)4-3-5-10(8)12;/h3-5,7H,2,6,16H2,1H3;1H |
| InChiKey: | InChIKey=DVXJZNCBVUSSDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.