* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 1600 |
| EnglishSynonyms: | RARECHEM AN KB 1600 |
| pro_mdlNumber: | MFCD08451822 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1c(cc(c(c1OC)OC)OC)C)N.Cl |
| InChi: | InChI=1S/C14H23NO3.ClH/c1-6-10(15)8-11-9(2)7-12(16-3)14(18-5)13(11)17-4;/h7,10H,6,8,15H2,1-5H3;1H |
| InChiKey: | InChIKey=WAZNISJHCFUZOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.