* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 1614 |
| EnglishSynonyms: | RARECHEM AN KB 1614 |
| pro_mdlNumber: | MFCD08451835 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | CCC(Cc1cc(ccc1O)CCl)N.Cl |
| InChi: | InChI=1S/C11H16ClNO.ClH/c1-2-10(13)6-9-5-8(7-12)3-4-11(9)14;/h3-5,10,14H,2,6-7,13H2,1H3;1H |
| InChiKey: | InChIKey=ZBXXORQBDUOQBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.