* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2115 |
| EnglishSynonyms: | RARECHEM AN KB 2115 |
| pro_mdlNumber: | MFCD08452329 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1cc(c(cc1C)OC)OCC)N.Cl |
| InChi: | InChI=1S/C14H23NO2.ClH/c1-5-12(15)8-11-9-14(17-6-2)13(16-4)7-10(11)3;/h7,9,12H,5-6,8,15H2,1-4H3;1H |
| InChiKey: | InChIKey=OXCSNNZHKSDPOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.