* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2275 |
| EnglishSynonyms: | RARECHEM AN KB 2275 |
| pro_mdlNumber: | MFCD08452478 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCC(Cc1ccc(nc1OC)OC)N.Cl |
| InChi: | InChI=1S/C11H18N2O2.ClH/c1-4-9(12)7-8-5-6-10(14-2)13-11(8)15-3;/h5-6,9H,4,7,12H2,1-3H3;1H |
| InChiKey: | InChIKey=MTGYJBLPMPYSPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.