* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2278 |
| EnglishSynonyms: | RARECHEM AN KB 2278 |
| pro_mdlNumber: | MFCD08452480 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCC(c1cc(cnc1)F)N.Cl |
| InChi: | InChI=1S/C8H11FN2.ClH/c1-2-8(10)6-3-7(9)5-11-4-6;/h3-5,8H,2,10H2,1H3;1H |
| InChiKey: | InChIKey=JCJHKUOWHDHFIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.