* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2284 |
| EnglishSynonyms: | RARECHEM AN KB 2284 |
| pro_mdlNumber: | MFCD08452484 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(C)CCCC/C=C\CCCCCCCC(CC)N.Cl |
| InChi: | InChI=1S/C20H41N.ClH/c1-4-19(3)17-15-13-11-9-7-6-8-10-12-14-16-18-20(21)5-2;/h7,9,19-20H,4-6,8,10-18,21H2,1-3H3;1H/b9-7-; |
| InChiKey: | InChIKey=AVKRSAGCOZQKEE-VILQZVERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.