* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2290 |
| EnglishSynonyms: | RARECHEM AN KB 2290 |
| pro_mdlNumber: | MFCD08452489 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(CC1CCCCCC1)N.Cl |
| InChi: | InChI=1S/C11H23N.ClH/c1-2-11(12)9-10-7-5-3-4-6-8-10;/h10-11H,2-9,12H2,1H3;1H |
| InChiKey: | InChIKey=KQGMOGIZEHMWCS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.