* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2292 |
| EnglishSynonyms: | RARECHEM AN KB 2292 |
| pro_mdlNumber: | MFCD08452490 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(CCCCc1ccc(cc1)c2ccccc2)N.Cl |
| InChi: | InChI=1S/C19H25N.ClH/c1-2-19(20)11-7-6-8-16-12-14-18(15-13-16)17-9-4-3-5-10-17;/h3-5,9-10,12-15,19H,2,6-8,11,20H2,1H3;1H |
| InChiKey: | InChIKey=ZAYQLVILAPFIOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.