* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2293 |
| EnglishSynonyms: | RARECHEM AN KB 2293 |
| pro_mdlNumber: | MFCD08452491 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(CCCCCc1ccc(cc1)c2ccccc2)N.Cl |
| InChi: | InChI=1S/C20H27N.ClH/c1-2-20(21)12-8-3-5-9-17-13-15-19(16-14-17)18-10-6-4-7-11-18;/h4,6-7,10-11,13-16,20H,2-3,5,8-9,12,21H2,1H3;1H |
| InChiKey: | InChIKey=IAOPIUMNNWIHAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.