* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2301 |
| EnglishSynonyms: | RARECHEM AN KB 2301 |
| pro_mdlNumber: | MFCD08452496 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CCC(Cc1ccc(cc1)c2c[nH]cn2)N.Cl |
| InChi: | InChI=1S/C13H17N3.ClH/c1-2-12(14)7-10-3-5-11(6-4-10)13-8-15-9-16-13;/h3-6,8-9,12H,2,7,14H2,1H3,(H,15,16);1H |
| InChiKey: | InChIKey=UWALUMGSOSYEIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.