* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2308 |
| EnglishSynonyms: | RARECHEM AN KB 2308 |
| pro_mdlNumber: | MFCD08452502 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CCC(Cc1cccc(c1)OCC(=O)O)N.Cl |
| InChi: | InChI=1S/C12H17NO3.ClH/c1-2-10(13)6-9-4-3-5-11(7-9)16-8-12(14)15;/h3-5,7,10H,2,6,8,13H2,1H3,(H,14,15);1H |
| InChiKey: | InChIKey=BEHKOESHMVOXPJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.