* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2309 |
| EnglishSynonyms: | RARECHEM AN KB 2309 |
| pro_mdlNumber: | MFCD08452503 |
| pro_acceptors: | 3 |
| pro_donors: | 3 |
| pro_smile: | CCC(Cc1cc(c(c(c1Br)Br)O)O)N.Cl |
| InChi: | InChI=1S/C10H13Br2NO2.ClH/c1-2-6(13)3-5-4-7(14)10(15)9(12)8(5)11;/h4,6,14-15H,2-3,13H2,1H3;1H |
| InChiKey: | InChIKey=SIDKEDCMJFRMBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.