* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2315 |
| EnglishSynonyms: | RARECHEM AN KB 2315 |
| pro_mdlNumber: | MFCD08452507 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCC(CCOCCc1ccccc1)N.Cl |
| InChi: | InChI=1S/C13H21NO.ClH/c1-2-13(14)9-11-15-10-8-12-6-4-3-5-7-12;/h3-7,13H,2,8-11,14H2,1H3;1H |
| InChiKey: | InChIKey=NUBVOTMPZCILJC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.